C22H33F3N6O2S — CID 144641164
(1E,3Z)-8-(5-amino-1,3,4-thiadiazol-2-yl)-1-N'-methylocta-1,3-diene-1,1,4-triamine;ethane;2-[3-(trifluoromethoxy)phenyl]acetaldehyde (PubChem CID 144641164) has the molecular formula C22H33F3N6O2S and a molecular weight of 502.61 g/mol. Its IUPAC name is (1E,3Z)-8-(5-amino-1,3,4-thiadiazol-2-yl)-1-N'-methylocta-1,3-diene-1,1,4-triamine;ethane;2-[3-(trifluoromethoxy)phenyl]acetaldehyde.
| Compound Name | (1E,3Z)-8-(5-amino-1,3,4-thiadiazol-2-yl)-1-N'-methylocta-1,3-diene-1,1,4-triamine;ethane;2-[3-(trifluoromethoxy)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 144641164 |
| Molecular Formula | C22H33F3N6O2S |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (1E,3Z)-8-(5-amino-1,3,4-thiadiazol-2-yl)-1-N'-methylocta-1,3-diene-1,1,4-triamine;ethane;2-[3-(trifluoromethoxy)phenyl]acetaldehyde |
| SMILES | CC.CN/C(N)=C/C=C(\N)CCCCc1nnc(N)s1.O=CCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H20N6S.C9H7F3O2.C2H6/c1-15-9(13)7-6-8(12)4-2-3-5-10-16-17-11(14)18-10;10-9(11,12)14-8-3-1-2-7(6-8)4-5-13;1-2/h6-7,15H,2-5,12-13H2,1H3,(H2,14,17);1-3,5-6H,4H2;1-2H3/b8-6-,9-7+;; |
| InChIKey | SQDJELPTZKRAJM-UYYQRFHASA-N |
| XLogP | 4.05 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|