C29H29F4N5O3S — CID 144878510
N-[5-[4-[3-fluoro-4-(methylamino)phenyl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-3-ylacetamide;2-[3-(trifluoromethoxy)phenyl]acetaldehyde (PubChem CID 144878510) has the molecular formula C29H29F4N5O3S and a molecular weight of 603.64 g/mol. Its IUPAC name is N-[5-[4-[3-fluoro-4-(methylamino)phenyl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-3-ylacetamide;2-[3-(trifluoromethoxy)phenyl]acetaldehyde.
| Compound Name | N-[5-[4-[3-fluoro-4-(methylamino)phenyl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-3-ylacetamide;2-[3-(trifluoromethoxy)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 144878510 |
| Molecular Formula | C29H29F4N5O3S |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | N-[5-[4-[3-fluoro-4-(methylamino)phenyl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-3-ylacetamide;2-[3-(trifluoromethoxy)phenyl]acetaldehyde |
| SMILES | CNc1ccc(CCCCc2nnc(NC(=O)Cc3cccnc3)s2)cc1F.O=CCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H22FN5OS.C9H7F3O2/c1-22-17-9-8-14(11-16(17)21)5-2-3-7-19-25-26-20(28-19)24-18(27)12-15-6-4-10-23-13-15;10-9(11,12)14-8-3-1-2-7(6-8)4-5-13/h4,6,8-11,13,22H,2-3,5,7,12H2,1H3,(H,24,26,27);1-3,5-6H,4H2 |
| InChIKey | YLJUPJHSZKKHSG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|