C25H29N7O2S2 — CID 135188595
(3Z,5Z)-3-ethenyl-N-[5-[5-[5-[(2-pyridin-3-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide (PubChem CID 135188595) has the molecular formula C25H29N7O2S2 and a molecular weight of 523.69 g/mol. Its IUPAC name is (3Z,5Z)-3-ethenyl-N-[5-[5-[5-[(2-pyridin-3-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-3-ethenyl-N-[5-[5-[5-[(2-pyridin-3-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide |
|---|---|
| PubChem CID | 135188595 |
| Molecular Formula | C25H29N7O2S2 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (3Z,5Z)-3-ethenyl-N-[5-[5-[5-[(2-pyridin-3-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide |
| SMILES | C=C/C(=C\C=C/C)CC(=O)Nc1nnc(CCCCCc2nnc(NC(=O)Cc3cccnc3)s2)s1 |
| InChI | InChI=1S/C25H29N7O2S2/c1-3-5-10-18(4-2)15-20(33)27-24-31-29-22(35-24)12-7-6-8-13-23-30-32-25(36-23)28-21(34)16-19-11-9-14-26-17-19/h3-5,9-11,14,17H,2,6-8,12-13,15-16H2,1H3,(H,27,31,33)(H,28,32,34)/b5-3-,18-10+ |
| InChIKey | ZVPBZUKOOWGYSM-JBWNDIFDSA-N |
| XLogP | 4.94 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|