C27H33N7O2S3 — CID 144631108
(3Z,5Z)-3-(2-methylbut-1-enyl)-N-[5-[3-[5-(pyridin-3-ylmethoxysulfanylamino)-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide (PubChem CID 144631108) has the molecular formula C27H33N7O2S3 and a molecular weight of 583.81 g/mol. Its IUPAC name is (3Z,5Z)-3-(2-methylbut-1-enyl)-N-[5-[3-[5-(pyridin-3-ylmethoxysulfanylamino)-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-3-(2-methylbut-1-enyl)-N-[5-[3-[5-(pyridin-3-ylmethoxysulfanylamino)-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide |
|---|---|
| PubChem CID | 144631108 |
| Molecular Formula | C27H33N7O2S3 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | (3Z,5Z)-3-(2-methylbut-1-enyl)-N-[5-[3-[5-(pyridin-3-ylmethoxysulfanylamino)-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide |
| SMILES | C/C=C\C=C(/C=C(C)CC)CC(=O)Nc1nnc(C2CCC(c3nnc(NSOCc4cccnc4)s3)C2)s1 |
| InChI | InChI=1S/C27H33N7O2S3/c1-4-6-8-19(13-18(3)5-2)14-23(35)29-26-32-30-24(37-26)21-10-11-22(15-21)25-31-33-27(38-25)34-39-36-17-20-9-7-12-28-16-20/h4,6-9,12-13,16,21-22H,5,10-11,14-15,17H2,1-3H3,(H,33,34)(H,29,32,35)/b6-4-,18-13?,19-8+ |
| InChIKey | UAWWOPQEUDADGW-XFSUULSZSA-N |
| XLogP | 7.22 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|