C24H26N4O2 — CID 136657856
N-[C-methyl-N-[(3Z)-3-[2-(pyridin-3-ylmethoxy)-4-pyridinyl]hepta-1,3,5-trien-2-yl]carbonimidoyl]cyclopropanecarboxamide (PubChem CID 136657856) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[C-methyl-N-[(3Z)-3-[2-(pyridin-3-ylmethoxy)-4-pyridinyl]hepta-1,3,5-trien-2-yl]carbonimidoyl]cyclopropanecarboxamide.
| Compound Name | N-[C-methyl-N-[(3Z)-3-[2-(pyridin-3-ylmethoxy)-4-pyridinyl]hepta-1,3,5-trien-2-yl]carbonimidoyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 136657856 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[C-methyl-N-[(3Z)-3-[2-(pyridin-3-ylmethoxy)-4-pyridinyl]hepta-1,3,5-trien-2-yl]carbonimidoyl]cyclopropanecarboxamide |
| SMILES | C=C(/N=C(\C)NC(=O)C1CC1)/C(=C\C=CC)c1ccnc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-4-5-8-22(17(2)27-18(3)28-24(29)20-9-10-20)21-11-13-26-23(14-21)30-16-19-7-6-12-25-15-19/h4-8,11-15,20H,2,9-10,16H2,1,3H3,(H,27,28,29)/b5-4?,22-8+ |
| InChIKey | NYJHBACTRSEHSC-UBZPUGBTSA-N |
| XLogP | 4.47 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|