C26H25FN6O2S — CID 118211082
2-(3-fluorophenyl)-N-[5-[4-[6-[(2-pyridin-3-ylacetyl)amino]-3-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 118211082) has the molecular formula C26H25FN6O2S and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[5-[4-[6-[(2-pyridin-3-ylacetyl)amino]-3-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[5-[4-[6-[(2-pyridin-3-ylacetyl)amino]-3-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 118211082 |
| Molecular Formula | C26H25FN6O2S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[5-[4-[6-[(2-pyridin-3-ylacetyl)amino]-3-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1cccnc1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3cccc(F)c3)s2)cn1 |
| InChI | InChI=1S/C26H25FN6O2S/c27-21-8-3-6-19(13-21)14-24(35)31-26-33-32-25(36-26)9-2-1-5-18-10-11-22(29-17-18)30-23(34)15-20-7-4-12-28-16-20/h3-4,6-8,10-13,16-17H,1-2,5,9,14-15H2,(H,29,30,34)(H,31,33,35) |
| InChIKey | NTLARVBIEKJZFM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|