C34H43N7O6S — CID 139499365
[2-[[5-[(5Z,7E)-5,8-diamino-8-[(2-phenylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-1-(3-methoxyphenyl)-2-oxoethyl] 3-morpholin-4-ylpropanoate (PubChem CID 139499365) has the molecular formula C34H43N7O6S and a molecular weight of 677.83 g/mol. Its IUPAC name is [2-[[5-[(5Z,7E)-5,8-diamino-8-[(2-phenylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-1-(3-methoxyphenyl)-2-oxoethyl] 3-morpholin-4-ylpropanoate.
| Compound Name | [2-[[5-[(5Z,7E)-5,8-diamino-8-[(2-phenylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-1-(3-methoxyphenyl)-2-oxoethyl] 3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 139499365 |
| Molecular Formula | C34H43N7O6S |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | [2-[[5-[(5Z,7E)-5,8-diamino-8-[(2-phenylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-1-(3-methoxyphenyl)-2-oxoethyl] 3-morpholin-4-ylpropanoate |
| SMILES | COc1cccc(C(OC(=O)CCN2CCOCC2)C(=O)Nc2nnc(CCCC/C(N)=C/C=C(\N)NC(=O)Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C34H43N7O6S/c1-45-27-12-7-10-25(23-27)32(47-31(43)16-17-41-18-20-46-21-19-41)33(44)38-34-40-39-30(48-34)13-6-5-11-26(35)14-15-28(36)37-29(42)22-24-8-3-2-4-9-24/h2-4,7-10,12,14-15,23,32H,5-6,11,13,16-22,35-36H2,1H3,(H,37,42)(H,38,40,44)/b26-14-,28-15+ |
| InChIKey | OLUFNEGJTMQBRR-WXJOGEKISA-N |
| XLogP | 3.21 |
| TPSA | 184.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|