C33H37N7O5S2 — CID 74982548
[3-oxo-2-phenyl-3-[[5-[4-[5-(2-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]propyl] 3-morpholin-4-ylpropanoate (PubChem CID 74982548) has the molecular formula C33H37N7O5S2 and a molecular weight of 675.84 g/mol. Its IUPAC name is [3-oxo-2-phenyl-3-[[5-[4-[5-(2-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]propyl] 3-morpholin-4-ylpropanoate.
| Compound Name | [3-oxo-2-phenyl-3-[[5-[4-[5-(2-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]propyl] 3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 74982548 |
| Molecular Formula | C33H37N7O5S2 |
| Molecular Weight | 675.84 g/mol |
| Exact Mass | 675.23 |
| IUPAC Name | [3-oxo-2-phenyl-3-[[5-[4-[5-(2-phenylprop-2-enoylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]propyl] 3-morpholin-4-ylpropanoate |
| SMILES | C=C(C(=O)Nc1nnc(CCCCc2nnc(NC(=O)C(COC(=O)CCN3CCOCC3)c3ccccc3)s2)s1)c1ccccc1 |
| InChI | InChI=1S/C33H37N7O5S2/c1-23(24-10-4-2-5-11-24)30(42)34-32-38-36-27(46-32)14-8-9-15-28-37-39-33(47-28)35-31(43)26(25-12-6-3-7-13-25)22-45-29(41)16-17-40-18-20-44-21-19-40/h2-7,10-13,26H,1,8-9,14-22H2,(H,34,38,42)(H,35,39,43) |
| InChIKey | FSSDALNTWOIGQN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 148.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|