C31H44N6O3S — CID 155261299
N-[(1E,3Z)-1,4-diamino-8-[5-[[1-hydroxy-2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 155261299) has the molecular formula C31H44N6O3S and a molecular weight of 580.80 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-8-[5-[[1-hydroxy-2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[1-hydroxy-2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 155261299 |
| Molecular Formula | C31H44N6O3S |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[1-hydroxy-2-[3-(2-hydroxy-2-methylpropyl)phenyl]ethyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-(3-methylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC1C=C(CC(=O)N/C(N)=C/C=C(\N)CCCCc2nnc(NC(O)Cc3cccc(CC(C)(C)O)c3)s2)C=CC1 |
| InChI | InChI=1S/C31H44N6O3S/c1-21-8-6-9-22(16-21)18-27(38)34-26(33)15-14-25(32)12-4-5-13-29-36-37-30(41-29)35-28(39)19-23-10-7-11-24(17-23)20-31(2,3)40/h6-7,9-11,14-17,21,28,39-40H,4-5,8,12-13,18-20,32-33H2,1-3H3,(H,34,38)(H,35,37)/b25-14-,26-15+ |
| InChIKey | MLWHBUWJUFAXLR-ACZYEWCVSA-N |
| XLogP | 4.21 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|