C20H20N6OS — CID 144992978
N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]formamide (PubChem CID 144992978) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]formamide.
| Compound Name | N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]formamide |
|---|---|
| PubChem CID | 144992978 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]formamide |
| SMILES | O=CNc1nnc(CCCCc2cc3cc(Cc4ccccc4)[nH]c3nn2)s1 |
| InChI | InChI=1S/C20H20N6OS/c27-13-21-20-26-24-18(28-20)9-5-4-8-16-11-15-12-17(22-19(15)25-23-16)10-14-6-2-1-3-7-14/h1-3,6-7,11-13H,4-5,8-10H2,(H,22,25)(H,21,26,27) |
| InChIKey | KQXCNUGZYLMURO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|