C21H28N6S — CID 144992991
5-[(Z)-6-amino-7-(2-amino-5-benzyl-1H-pyrrol-3-yl)hept-6-enyl]-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 144992991) has the molecular formula C21H28N6S and a molecular weight of 396.56 g/mol. Its IUPAC name is 5-[(Z)-6-amino-7-(2-amino-5-benzyl-1H-pyrrol-3-yl)hept-6-enyl]-N-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(Z)-6-amino-7-(2-amino-5-benzyl-1H-pyrrol-3-yl)hept-6-enyl]-N-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 144992991 |
| Molecular Formula | C21H28N6S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 5-[(Z)-6-amino-7-(2-amino-5-benzyl-1H-pyrrol-3-yl)hept-6-enyl]-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(CCCCC/C(N)=C/c2cc(Cc3ccccc3)[nH]c2N)s1 |
| InChI | InChI=1S/C21H28N6S/c1-24-21-27-26-19(28-21)11-7-3-6-10-17(22)13-16-14-18(25-20(16)23)12-15-8-4-2-5-9-15/h2,4-5,8-9,13-14,25H,3,6-7,10-12,22-23H2,1H3,(H,24,27)/b17-13- |
| InChIKey | FBJYDNUDFPNRDO-LGMDPLHJSA-N |
| XLogP | 4.18 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|