C27H26N6OS — CID 118621010
N-[5-[4-(2-benzyl-1H-imidazo[4,5-b]pyridin-6-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 118621010) has the molecular formula C27H26N6OS and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[5-[4-(2-benzyl-1H-imidazo[4,5-b]pyridin-6-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[4-(2-benzyl-1H-imidazo[4,5-b]pyridin-6-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 118621010 |
| Molecular Formula | C27H26N6OS |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[5-[4-(2-benzyl-1H-imidazo[4,5-b]pyridin-6-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nnc(CCCCc2cnc3nc(Cc4ccccc4)[nH]c3c2)s1 |
| InChI | InChI=1S/C27H26N6OS/c34-24(17-20-11-5-2-6-12-20)31-27-33-32-25(35-27)14-8-7-13-21-15-22-26(28-18-21)30-23(29-22)16-19-9-3-1-4-10-19/h1-6,9-12,15,18H,7-8,13-14,16-17H2,(H,28,29,30)(H,31,33,34) |
| InChIKey | JSAOQVBPDYTXHV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|