C29H36N6OS — CID 144993038
N-[5-[(Z)-5-amino-6-(2-amino-5-benzyl-1H-pyrrol-3-yl)hex-5-enyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide;ethane (PubChem CID 144993038) has the molecular formula C29H36N6OS and a molecular weight of 516.72 g/mol. Its IUPAC name is N-[5-[(Z)-5-amino-6-(2-amino-5-benzyl-1H-pyrrol-3-yl)hex-5-enyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide;ethane.
| Compound Name | N-[5-[(Z)-5-amino-6-(2-amino-5-benzyl-1H-pyrrol-3-yl)hex-5-enyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide;ethane |
|---|---|
| PubChem CID | 144993038 |
| Molecular Formula | C29H36N6OS |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | N-[5-[(Z)-5-amino-6-(2-amino-5-benzyl-1H-pyrrol-3-yl)hex-5-enyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide;ethane |
| SMILES | CC.N/C(=C\c1cc(Cc2ccccc2)[nH]c1N)CCCCc1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C27H30N6OS.C2H6/c28-22(17-21-18-23(30-26(21)29)15-19-9-3-1-4-10-19)13-7-8-14-25-32-33-27(35-25)31-24(34)16-20-11-5-2-6-12-20;1-2/h1-6,9-12,17-18,30H,7-8,13-16,28-29H2,(H,31,33,34);1-2H3/b22-17-; |
| InChIKey | UNGQJUOIWWALLP-JJECXDOKSA-N |
| XLogP | 5.96 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|