C23H35N5O2S — CID 166875802
N-[2-[butyl(ethyl)amino]ethyl]-5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 166875802) has the molecular formula C23H35N5O2S and a molecular weight of 445.63 g/mol. Its IUPAC name is N-[2-[butyl(ethyl)amino]ethyl]-5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[2-[butyl(ethyl)amino]ethyl]-5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 166875802 |
| Molecular Formula | C23H35N5O2S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[2-[butyl(ethyl)amino]ethyl]-5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCN(CC)CCNC(=O)CCCCc1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C23H35N5O2S/c1-3-5-16-28(4-2)17-15-24-20(29)13-9-10-14-22-26-27-23(31-22)25-21(30)18-19-11-7-6-8-12-19/h6-8,11-12H,3-5,9-10,13-18H2,1-2H3,(H,24,29)(H,25,27,30) |
| InChIKey | QXERGMCLFWEQPK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|