C21H29N5O2S — CID 71457143
5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-(2-pyrrolidin-1-ylethyl)pentanamide (PubChem CID 71457143) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-(2-pyrrolidin-1-ylethyl)pentanamide.
| Compound Name | 5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-(2-pyrrolidin-1-ylethyl)pentanamide |
|---|---|
| PubChem CID | 71457143 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-(2-pyrrolidin-1-ylethyl)pentanamide |
| SMILES | O=C(CCCCc1nnc(NC(=O)Cc2ccccc2)s1)NCCN1CCCC1 |
| InChI | InChI=1S/C21H29N5O2S/c27-18(22-12-15-26-13-6-7-14-26)10-4-5-11-20-24-25-21(29-20)23-19(28)16-17-8-2-1-3-9-17/h1-3,8-9H,4-7,10-16H2,(H,22,27)(H,23,25,28) |
| InChIKey | UPLGSCROHQZZQN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|