C28H35N5O2S — CID 71453647
5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[2-(4-phenylpiperidin-1-yl)ethyl]pentanamide (PubChem CID 71453647) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is 5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[2-(4-phenylpiperidin-1-yl)ethyl]pentanamide.
| Compound Name | 5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[2-(4-phenylpiperidin-1-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 71453647 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 5-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[2-(4-phenylpiperidin-1-yl)ethyl]pentanamide |
| SMILES | O=C(CCCCc1nnc(NC(=O)Cc2ccccc2)s1)NCCN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H35N5O2S/c34-25(29-17-20-33-18-15-24(16-19-33)23-11-5-2-6-12-23)13-7-8-14-27-31-32-28(36-27)30-26(35)21-22-9-3-1-4-10-22/h1-6,9-12,24H,7-8,13-21H2,(H,29,34)(H,30,32,35) |
| InChIKey | DXTWZKQUXJCHAK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|