C26H26Cl2N6O2S — CID 144921975
2-(4,5-dichlorocyclohexa-1,3-dien-1-yl)-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 144921975) has the molecular formula C26H26Cl2N6O2S and a molecular weight of 557.51 g/mol. Its IUPAC name is 2-(4,5-dichlorocyclohexa-1,3-dien-1-yl)-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4,5-dichlorocyclohexa-1,3-dien-1-yl)-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 144921975 |
| Molecular Formula | C26H26Cl2N6O2S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-(4,5-dichlorocyclohexa-1,3-dien-1-yl)-N-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(CCCCc2nnc(NC(=O)CC3=CC=C(Cl)C(Cl)C3)s2)nn1 |
| InChI | InChI=1S/C26H26Cl2N6O2S/c27-20-12-10-18(14-21(20)28)16-24(36)30-26-34-33-25(37-26)9-5-4-8-19-11-13-22(32-31-19)29-23(35)15-17-6-2-1-3-7-17/h1-3,6-7,10-13,21H,4-5,8-9,14-16H2,(H,29,32,35)(H,30,34,36) |
| InChIKey | XOUZXXYRENICIP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|