C33H39N5O4S2 — CID 123907775
2-(3-methoxyphenyl)-N-[2-[3-[5-[[2-(3-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-6-methyl-4,5-dihydro-1,3-thiazepin-7-yl]acetamide (PubChem CID 123907775) has the molecular formula C33H39N5O4S2 and a molecular weight of 633.84 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[2-[3-[5-[[2-(3-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-6-methyl-4,5-dihydro-1,3-thiazepin-7-yl]acetamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[2-[3-[5-[[2-(3-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-6-methyl-4,5-dihydro-1,3-thiazepin-7-yl]acetamide |
|---|---|
| PubChem CID | 123907775 |
| Molecular Formula | C33H39N5O4S2 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[2-[3-[5-[[2-(3-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-6-methyl-4,5-dihydro-1,3-thiazepin-7-yl]acetamide |
| SMILES | COc1cccc(CC(=O)NC2=C(C)CCN=C(C3CCCCC(c4nnc(NC(=O)Cc5cccc(OC)c5)s4)C3)S2)c1 |
| InChI | InChI=1S/C33H39N5O4S2/c1-21-14-15-34-31(43-30(21)35-28(39)18-22-8-6-12-26(16-22)41-2)24-10-4-5-11-25(20-24)32-37-38-33(44-32)36-29(40)19-23-9-7-13-27(17-23)42-3/h6-9,12-13,16-17,24-25H,4-5,10-11,14-15,18-20H2,1-3H3,(H,35,39)(H,36,38,40) |
| InChIKey | KHHQDSLCCBJUEN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |