C29H32N6O4S2 — CID 90163300
2-(2-methoxyphenyl)-N-[5-[(1S,3R)-3-[5-[[2-(2-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 90163300) has the molecular formula C29H32N6O4S2 and a molecular weight of 592.75 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N-[5-[(1S,3R)-3-[5-[[2-(2-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-methoxyphenyl)-N-[5-[(1S,3R)-3-[5-[[2-(2-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 90163300 |
| Molecular Formula | C29H32N6O4S2 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-(2-methoxyphenyl)-N-[5-[(1S,3R)-3-[5-[[2-(2-methoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cycloheptyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1nnc([C@@H]2CCCC[C@H](c3nnc(NC(=O)Cc4ccccc4OC)s3)C2)s1 |
| InChI | InChI=1S/C29H32N6O4S2/c1-38-22-13-7-5-9-18(22)16-24(36)30-28-34-32-26(40-28)20-11-3-4-12-21(15-20)27-33-35-29(41-27)31-25(37)17-19-10-6-8-14-23(19)39-2/h5-10,13-14,20-21H,3-4,11-12,15-17H2,1-2H3,(H,30,34,36)(H,31,35,37)/t20-,21+ |
| InChIKey | BQRDCPQHODZGOV-OYRHEFFESA-N |
| XLogP | 5.60 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |