C21H25N7O2S2 — CID 138481270
2-(2-acetamidophenyl)-N-[5-[(1S,3S)-3-[5-(methylamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 138481270) has the molecular formula C21H25N7O2S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-(2-acetamidophenyl)-N-[5-[(1S,3S)-3-[5-(methylamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-acetamidophenyl)-N-[5-[(1S,3S)-3-[5-(methylamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 138481270 |
| Molecular Formula | C21H25N7O2S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-(2-acetamidophenyl)-N-[5-[(1S,3S)-3-[5-(methylamino)-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CNc1nnc([C@H]2CCC[C@H](c3nnc(NC(=O)Cc4ccccc4NC(C)=O)s3)C2)s1 |
| InChI | InChI=1S/C21H25N7O2S2/c1-12(29)23-16-9-4-3-6-13(16)11-17(30)24-21-28-26-19(32-21)15-8-5-7-14(10-15)18-25-27-20(22-2)31-18/h3-4,6,9,14-15H,5,7-8,10-11H2,1-2H3,(H,22,27)(H,23,29)(H,24,28,30)/t14-,15-/m0/s1 |
| InChIKey | MWBRBTIQJQGMSE-GJZGRUSLSA-N |
| XLogP | 4.01 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |