C26H24N8O6S2 — CID 90163241
2-(2-nitrophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(2-nitrophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 90163241) has the molecular formula C26H24N8O6S2 and a molecular weight of 608.66 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(2-nitrophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(2-nitrophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 90163241 |
| Molecular Formula | C26H24N8O6S2 |
| Molecular Weight | 608.66 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[5-[(1S,3S)-3-[5-[[2-(2-nitrophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1nnc([C@H]2CCC[C@H](c3nnc(NC(=O)Cc4ccccc4[N+](=O)[O-])s3)C2)s1 |
| InChI | InChI=1S/C26H24N8O6S2/c35-21(13-15-6-1-3-10-19(15)33(37)38)27-25-31-29-23(41-25)17-8-5-9-18(12-17)24-30-32-26(42-24)28-22(36)14-16-7-2-4-11-20(16)34(39)40/h1-4,6-7,10-11,17-18H,5,8-9,12-14H2,(H,27,31,35)(H,28,32,36)/t17-,18-/m0/s1 |
| InChIKey | WQZKNRYIAXMYSL-ROUUACIJSA-N |
| XLogP | 5.01 |
| TPSA | 196.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|