C29H34N6O2S2 — CID 123305138
N-[5-[3-[3-methyl-5-[[2-(3-methylphenyl)acetyl]amino]-2H-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methylphenyl)acetamide (PubChem CID 123305138) has the molecular formula C29H34N6O2S2 and a molecular weight of 562.77 g/mol. Its IUPAC name is N-[5-[3-[3-methyl-5-[[2-(3-methylphenyl)acetyl]amino]-2H-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[5-[3-[3-methyl-5-[[2-(3-methylphenyl)acetyl]amino]-2H-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 123305138 |
| Molecular Formula | C29H34N6O2S2 |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-[5-[3-[3-methyl-5-[[2-(3-methylphenyl)acetyl]amino]-2H-1,3,4-thiadiazol-2-yl]cyclohexyl]-1,3,4-thiadiazol-2-yl]-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)NC2=NN(C)C(C3CCCC(c4nnc(NC(=O)Cc5cccc(C)c5)s4)C3)S2)c1 |
| InChI | InChI=1S/C29H34N6O2S2/c1-18-7-4-9-20(13-18)15-24(36)30-28-33-32-26(38-28)22-11-6-12-23(17-22)27-35(3)34-29(39-27)31-25(37)16-21-10-5-8-19(2)14-21/h4-5,7-10,13-14,22-23,27H,6,11-12,15-17H2,1-3H3,(H,30,33,36)(H,31,34,37) |
| InChIKey | PLWFWUVEGKMSTP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |