C22H18N4O3S — CID 17171794
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide (PubChem CID 17171794) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17171794 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1nnc(C2CC2)s1)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O |
| InChI | InChI=1S/C22H18N4O3S/c27-18(23-22-25-24-19(30-22)14-6-7-14)15-8-9-16-17(12-15)21(29)26(20(16)28)11-10-13-4-2-1-3-5-13/h1-5,8-9,12,14H,6-7,10-11H2,(H,23,25,27) |
| InChIKey | HPIDJTSXEWDOGI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|