C25H24N4O5S — CID 108737435
N-[[2-(2-methylphenyl)-1,3-thiazol-4-yl]methyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 108737435) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is N-[[2-(2-methylphenyl)-1,3-thiazol-4-yl]methyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[[2-(2-methylphenyl)-1,3-thiazol-4-yl]methyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 108737435 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-[[2-(2-methylphenyl)-1,3-thiazol-4-yl]methyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | Cc1ccccc1-c1nc(CNC(=O)CCCCCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cs1 |
| InChI | InChI=1S/C25H24N4O5S/c1-16-8-4-5-9-18(16)23-27-17(15-35-23)14-26-21(30)12-3-2-6-13-28-24(31)19-10-7-11-20(29(33)34)22(19)25(28)32/h4-5,7-11,15H,2-3,6,12-14H2,1H3,(H,26,30) |
| InChIKey | KQPWUAYDXKAAPZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|