C26H23NO8 — CID 3724475
[4-[2-[5-(3-acetylanilino)-5-oxopentanoyl]oxyacetyl]phenyl] furan-2-carboxylate (PubChem CID 3724475) has the molecular formula C26H23NO8 and a molecular weight of 477.47 g/mol. Its IUPAC name is [4-[2-[5-(3-acetylanilino)-5-oxopentanoyl]oxyacetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[5-(3-acetylanilino)-5-oxopentanoyl]oxyacetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3724475 |
| Molecular Formula | C26H23NO8 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [4-[2-[5-(3-acetylanilino)-5-oxopentanoyl]oxyacetyl]phenyl] furan-2-carboxylate |
| SMILES | CC(=O)c1cccc(NC(=O)CCCC(=O)OCC(=O)c2ccc(OC(=O)c3ccco3)cc2)c1 |
| InChI | InChI=1S/C26H23NO8/c1-17(28)19-5-2-6-20(15-19)27-24(30)8-3-9-25(31)34-16-22(29)18-10-12-21(13-11-18)35-26(32)23-7-4-14-33-23/h2,4-7,10-15H,3,8-9,16H2,1H3,(H,27,30) |
| InChIKey | RIVCQBYCTCBBLD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|