C23H18ClNO7 — CID 4989235
[4-[2-[4-(3-chloroanilino)-4-oxobutanoyl]oxyacetyl]phenyl] furan-2-carboxylate (PubChem CID 4989235) has the molecular formula C23H18ClNO7 and a molecular weight of 455.85 g/mol. Its IUPAC name is [4-[2-[4-(3-chloroanilino)-4-oxobutanoyl]oxyacetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[4-(3-chloroanilino)-4-oxobutanoyl]oxyacetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 4989235 |
| Molecular Formula | C23H18ClNO7 |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [4-[2-[4-(3-chloroanilino)-4-oxobutanoyl]oxyacetyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(CCC(=O)OCC(=O)c1ccc(OC(=O)c2ccco2)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClNO7/c24-16-3-1-4-17(13-16)25-21(27)10-11-22(28)31-14-19(26)15-6-8-18(9-7-15)32-23(29)20-5-2-12-30-20/h1-9,12-13H,10-11,14H2,(H,25,27) |
| InChIKey | MDYKGBJUBTTYCD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|