C17H23N5O3S — CID 120921380
N-[2-(benzenesulfonamido)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120921380) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120921380 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccccc1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C17H23N5O3S/c23-16(17(7-10-18-11-8-17)22-14-4-9-20-22)19-12-13-21-26(24,25)15-5-2-1-3-6-15/h1-6,9,14,18,21H,7-8,10-13H2,(H,19,23) |
| InChIKey | MEURMBXRZWHQBA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|