C16H24N2O4 — CID 119694181
4-methoxy-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 119694181) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-methoxy-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-methoxy-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119694181 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-methoxy-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2(OC)CCNCC2)cc1 |
| InChI | InChI=1S/C16H24N2O4/c1-20-13-3-5-14(6-4-13)22-12-11-18-15(19)16(21-2)7-9-17-10-8-16/h3-6,17H,7-12H2,1-2H3,(H,18,19) |
| InChIKey | FRMIQCJWYACSEJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|