C20H29N3O4 — CID 119741739
N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119741739) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119741739 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-4-methoxypiperidine-4-carboxamide |
| SMILES | COC1(C(=O)NCCc2ccc(OCC(=O)NC3CC3)cc2)CCNCC1 |
| InChI | InChI=1S/C20H29N3O4/c1-26-20(9-12-21-13-10-20)19(25)22-11-8-15-2-6-17(7-3-15)27-14-18(24)23-16-4-5-16/h2-3,6-7,16,21H,4-5,8-14H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | QMKLHCCMCRLWGS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |