C19H28N2O5 — CID 119787961
methyl 4-[4-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]butanoate (PubChem CID 119787961) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is methyl 4-[4-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 119787961 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl 4-[4-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(CNC(=O)C2(OC)CCNCC2)cc1 |
| InChI | InChI=1S/C19H28N2O5/c1-24-17(22)4-3-13-26-16-7-5-15(6-8-16)14-21-18(23)19(25-2)9-11-20-12-10-19/h5-8,20H,3-4,9-14H2,1-2H3,(H,21,23) |
| InChIKey | PFLYVYAJLSSZDK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|