C17H24N2O5 — CID 119787129
methyl 2-[3-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]acetate (PubChem CID 119787129) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 2-[3-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 119787129 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 2-[3-[[(4-methoxypiperidine-4-carbonyl)amino]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(CNC(=O)C2(OC)CCNCC2)c1 |
| InChI | InChI=1S/C17H24N2O5/c1-22-15(20)12-24-14-5-3-4-13(10-14)11-19-16(21)17(23-2)6-8-18-9-7-17/h3-5,10,18H,6-9,11-12H2,1-2H3,(H,19,21) |
| InChIKey | UAFPJPAHEVLBIJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |