C16H23ClN2O5 — CID 119735567
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119735567) has the molecular formula C16H23ClN2O5 and a molecular weight of 358.82 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119735567 |
| Molecular Formula | C16H23ClN2O5 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NCCOc2ccc3c(c2)OCO3)CCNCC1.Cl |
| InChI | InChI=1S/C16H22N2O5.ClH/c1-20-16(4-6-17-7-5-16)15(19)18-8-9-21-12-2-3-13-14(10-12)23-11-22-13;/h2-3,10,17H,4-9,11H2,1H3,(H,18,19);1H |
| InChIKey | YQTAUQUPJKOVHQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|