C14H13F3N4O2 — CID 60507961
4-hydroxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 60507961) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | 4-hydroxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 60507961 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-hydroxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1nccc(C(F)(F)F)n1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H13F3N4O2/c15-14(16,17)11-5-6-19-13(21-11)20-8-7-18-12(23)9-1-3-10(22)4-2-9/h1-6,22H,7-8H2,(H,18,23)(H,19,20,21) |
| InChIKey | BKFLPLUMNGLWSX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|