C9H11F3N4O — CID 60732159
N-ethyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide (PubChem CID 60732159) has the molecular formula C9H11F3N4O and a molecular weight of 248.21 g/mol. Its IUPAC name is N-ethyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide.
| Compound Name | N-ethyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 60732159 |
| Molecular Formula | C9H11F3N4O |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-ethyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide |
| SMILES | CCNC(=O)CNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N4O/c1-2-13-7(17)5-15-8-14-4-3-6(16-8)9(10,11)12/h3-4H,2,5H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | QLURVSKFKGCFOW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |