C16H21F3N8O — CID 119708103
5-methyl-1-piperidin-4-yl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]triazole-4-carboxamide (PubChem CID 119708103) has the molecular formula C16H21F3N8O and a molecular weight of 398.39 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119708103 |
| Molecular Formula | C16H21F3N8O |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCNc2nccc(C(F)(F)F)n2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C16H21F3N8O/c1-10-13(25-26-27(10)11-2-5-20-6-3-11)14(28)21-8-9-23-15-22-7-4-12(24-15)16(17,18)19/h4,7,11,20H,2-3,5-6,8-9H2,1H3,(H,21,28)(H,22,23,24) |
| InChIKey | HBWWPDZZBGSTRQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|