C17H23N5OS — CID 119691404
5-methyl-N-(2-phenylsulfanylethyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119691404) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 5-methyl-N-(2-phenylsulfanylethyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-(2-phenylsulfanylethyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119691404 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-methyl-N-(2-phenylsulfanylethyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCSc2ccccc2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C17H23N5OS/c1-13-16(20-21-22(13)14-7-9-18-10-8-14)17(23)19-11-12-24-15-5-3-2-4-6-15/h2-6,14,18H,7-12H2,1H3,(H,19,23) |
| InChIKey | JSWCGTHQFMAXTH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|