C23H27N5O — CID 119688023
N-(2,2-diphenylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119688023) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(2,2-diphenylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119688023 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | N-(2,2-diphenylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCC(c2ccccc2)c2ccccc2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C23H27N5O/c1-17-22(26-27-28(17)20-12-14-24-15-13-20)23(29)25-16-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20-21,24H,12-16H2,1H3,(H,25,29) |
| InChIKey | WJNFQNNYHWIJON-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |