C17H22ClN5O — CID 119705388
N-[2-(2-chlorophenyl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119705388) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119705388 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2ccccc2Cl)nnn1C1CCNCC1 |
| InChI | InChI=1S/C17H22ClN5O/c1-12-16(21-22-23(12)14-7-9-19-10-8-14)17(24)20-11-6-13-4-2-3-5-15(13)18/h2-5,14,19H,6-11H2,1H3,(H,20,24) |
| InChIKey | CEWLCBAHZWLYKY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |