C19H25ClN6O — CID 126792948
N-[2-(1H-indol-3-yl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 126792948) has the molecular formula C19H25ClN6O and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126792948 |
| Molecular Formula | C19H25ClN6O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCc2c[nH]c3ccccc23)nnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C19H24N6O.ClH/c1-13-18(23-24-25(13)15-7-9-20-10-8-15)19(26)21-11-6-14-12-22-17-5-3-2-4-16(14)17;/h2-5,12,15,20,22H,6-11H2,1H3,(H,21,26);1H |
| InChIKey | BBVUEJOOXSUMNW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |