C17H30ClN5O — CID 119725707
N-(2-cyclohexylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119725707) has the molecular formula C17H30ClN5O and a molecular weight of 355.91 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-cyclohexylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119725707 |
| Molecular Formula | C17H30ClN5O |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-(2-cyclohexylethyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCC2CCCCC2)nnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C17H29N5O.ClH/c1-13-16(20-21-22(13)15-8-10-18-11-9-15)17(23)19-12-7-14-5-3-2-4-6-14;/h14-15,18H,2-12H2,1H3,(H,19,23);1H |
| InChIKey | VPZGJSBJLRJCKR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |