C17H30N6O — CID 124696094
5-methyl-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 124696094) has the molecular formula C17H30N6O and a molecular weight of 334.47 g/mol. Its IUPAC name is 5-methyl-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 124696094 |
| Molecular Formula | C17H30N6O |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 5-methyl-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCCC[C@H]2C)nnn1C1CCNCC1 |
| InChI | InChI=1S/C17H30N6O/c1-13-5-3-4-11-22(13)12-10-19-17(24)16-14(2)23(21-20-16)15-6-8-18-9-7-15/h13,15,18H,3-12H2,1-2H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | FMVQMXSVKCBWBB-CYBMUJFWSA-N |
| XLogP | 1.12 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |