C16H28ClN5O — CID 119716278
5-methyl-N-(3-methylcyclohexyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119716278) has the molecular formula C16H28ClN5O and a molecular weight of 341.89 g/mol. Its IUPAC name is 5-methyl-N-(3-methylcyclohexyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-N-(3-methylcyclohexyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119716278 |
| Molecular Formula | C16H28ClN5O |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 5-methyl-N-(3-methylcyclohexyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NC2CCCC(C)C2)nnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C16H27N5O.ClH/c1-11-4-3-5-13(10-11)18-16(22)15-12(2)21(20-19-15)14-6-8-17-9-7-14;/h11,13-14,17H,3-10H2,1-2H3,(H,18,22);1H |
| InChIKey | POPQRORHQJVDDA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |