C14H26ClN5O — CID 119678385
5-methyl-N-(3-methylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119678385) has the molecular formula C14H26ClN5O and a molecular weight of 315.85 g/mol. Its IUPAC name is 5-methyl-N-(3-methylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-N-(3-methylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119678385 |
| Molecular Formula | C14H26ClN5O |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 5-methyl-N-(3-methylbutan-2-yl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NC(C)C(C)C)nnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C14H25N5O.ClH/c1-9(2)10(3)16-14(20)13-11(4)19(18-17-13)12-5-7-15-8-6-12;/h9-10,12,15H,5-8H2,1-4H3,(H,16,20);1H |
| InChIKey | PMEVBVNOAGUGTD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |