C18H34ClN5O — CID 119811871
5-methyl-1-piperidin-4-yl-N-(2-propylhexyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119811871) has the molecular formula C18H34ClN5O and a molecular weight of 371.96 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-(2-propylhexyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-(2-propylhexyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119811871 |
| Molecular Formula | C18H34ClN5O |
| Molecular Weight | 371.96 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-(2-propylhexyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CCCCC(CCC)CNC(=O)c1nnn(C2CCNCC2)c1C.Cl |
| InChI | InChI=1S/C18H33N5O.ClH/c1-4-6-8-15(7-5-2)13-20-18(24)17-14(3)23(22-21-17)16-9-11-19-12-10-16;/h15-16,19H,4-13H2,1-3H3,(H,20,24);1H |
| InChIKey | SEYAVMUHFZMSGY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.96 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |