C20H36N6O2 — CID 119841658
N-(3-ethyl-2-morpholin-4-ylpentyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119841658) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119841658 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)c1nnn(C2CCNCC2)c1C)N1CCOCC1 |
| InChI | InChI=1S/C20H36N6O2/c1-4-16(5-2)18(25-10-12-28-13-11-25)14-22-20(27)19-15(3)26(24-23-19)17-6-8-21-9-7-17/h16-18,21H,4-14H2,1-3H3,(H,22,27) |
| InChIKey | BCDZBRNDJHTXMO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |