C19H34N6O2 — CID 119841672
N-(3-ethyl-2-morpholin-4-ylpentyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119841672) has the molecular formula C19H34N6O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119841672 |
| Molecular Formula | C19H34N6O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)c1cn(C2CCNCC2)nn1)N1CCOCC1 |
| InChI | InChI=1S/C19H34N6O2/c1-3-15(4-2)18(24-9-11-27-12-10-24)13-21-19(26)17-14-25(23-22-17)16-5-7-20-8-6-16/h14-16,18,20H,3-13H2,1-2H3,(H,21,26) |
| InChIKey | WODQRUXIYCRNDW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |