C20H28ClN5O — CID 119799876
N-[1-(4-chlorophenyl)-3-methylbutyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119799876) has the molecular formula C20H28ClN5O and a molecular weight of 389.93 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-methylbutyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-methylbutyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119799876 |
| Molecular Formula | C20H28ClN5O |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-methylbutyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(CC(C)C)c2ccc(Cl)cc2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C20H28ClN5O/c1-13(2)12-18(15-4-6-16(21)7-5-15)23-20(27)19-14(3)26(25-24-19)17-8-10-22-11-9-17/h4-7,13,17-18,22H,8-12H2,1-3H3,(H,23,27) |
| InChIKey | RDQODGOJZXIFRF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |