C20H29N5O2 — CID 119784371
5-methyl-1-piperidin-4-yl-N-[2-(2-propan-2-ylphenoxy)ethyl]triazole-4-carboxamide (PubChem CID 119784371) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-[2-(2-propan-2-ylphenoxy)ethyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-[2-(2-propan-2-ylphenoxy)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119784371 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-[2-(2-propan-2-ylphenoxy)ethyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCOc2ccccc2C(C)C)nnn1C1CCNCC1 |
| InChI | InChI=1S/C20H29N5O2/c1-14(2)17-6-4-5-7-18(17)27-13-12-22-20(26)19-15(3)25(24-23-19)16-8-10-21-11-9-16/h4-7,14,16,21H,8-13H2,1-3H3,(H,22,26) |
| InChIKey | ANDANLPGYAZWSD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|