C17H24ClN7O3 — CID 119692360
5-methyl-N-[2-(2-nitroanilino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119692360) has the molecular formula C17H24ClN7O3 and a molecular weight of 409.88 g/mol. Its IUPAC name is 5-methyl-N-[2-(2-nitroanilino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-N-[2-(2-nitroanilino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119692360 |
| Molecular Formula | C17H24ClN7O3 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 5-methyl-N-[2-(2-nitroanilino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCNc2ccccc2[N+](=O)[O-])nnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C17H23N7O3.ClH/c1-12-16(21-22-23(12)13-6-8-18-9-7-13)17(25)20-11-10-19-14-4-2-3-5-15(14)24(26)27;/h2-5,13,18-19H,6-11H2,1H3,(H,20,25);1H |
| InChIKey | YPZKWLASNNFJQF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|