C16H21ClN6O3 — CID 119670814
5-methyl-N-(4-methyl-3-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119670814) has the molecular formula C16H21ClN6O3 and a molecular weight of 380.84 g/mol. Its IUPAC name is 5-methyl-N-(4-methyl-3-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-N-(4-methyl-3-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119670814 |
| Molecular Formula | C16H21ClN6O3 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 5-methyl-N-(4-methyl-3-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)c2nnn(C3CCNCC3)c2C)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H20N6O3.ClH/c1-10-3-4-12(9-14(10)22(24)25)18-16(23)15-11(2)21(20-19-15)13-5-7-17-8-6-13;/h3-4,9,13,17H,5-8H2,1-2H3,(H,18,23);1H |
| InChIKey | KMUFKVIPVNXDAX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|